2-Methyl-3-(thiophen-2-yl)quinoxaline - CAS 1023558-03-3

2-Methyl-3-(thiophen-2-yl)quinoxaline(CAT: L001025) is a noteworthy chemical compound with versatile applications. In the realm of organic chemistry, its unique quinoxaline structure, combined with the thiophenyl moiety, makes it a valuable building block for the synthesis of complex molecules. The incorporation of the methyl group adds further diversity to its potential applications.

Catalog Number: L001025

CAS Number: 1023558-03-3

Molecular Formula: C13H10N2S

Molecular Weight:226.3

Purity: ≥95%

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C13H10N2S
Molecular Weight226.3
Purity≥95%

Computed Descriptor

IUPAC Name2-methyl-3-thiophen-2-ylquinoxaline
InChIInChI=1S/C13H10N2S/c1-9-13(12-7-4-8-16-12)15-11-6-3-2-5-10(11)14-9/h2-8H,1H3
InChIKeyZXZRMFGGDBQQRR-UHFFFAOYSA-N