For research use only. Not for therapeutic Use.
2-Methyl-3-(2-pyrrolidinylmethoxy)pyridine(Cat No.:L007516), is a chemical compound with a molecular structure featuring a pyridine ring substituted with a methyl group and a pyrrolidinylmethoxy group. This compound is notable in medicinal chemistry, particularly in drug discovery research. Its unique structure suggests potential pharmacological activities, making it valuable for further exploration in developing therapeutic agents.
CAS Number | 1856346-16-1 |
Molecular Formula | C11H16N2O |
Purity | ≥95% |
IUPAC Name | 2-methyl-3-(pyrrolidin-2-ylmethoxy)pyridine |
InChI | InChI=1S/C11H16N2O/c1-9-11(5-3-6-12-9)14-8-10-4-2-7-13-10/h3,5-6,10,13H,2,4,7-8H2,1H3 |
InChIKey | YRVIKLBSVVNSHF-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC=N1)OCC2CCCN2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |