For research use only. Not for therapeutic Use.
2-Methyl-1-(p-tolyl)propan-1-amine hydrochloride(Cat No.:L007857), with the chemical formula C11H18ClN. This compound consists of an amine group attached to a propan-1-amine backbone, where the propan-1-amine is substituted with a methyl group at the 2-position and a p-tolyl group (methylphenyl) at the 1-position. The hydrochloride salt form enhances its solubility and stability, making it suitable for various chemical applications. Compounds with similar structures are often used as intermediates in the synthesis of pharmaceuticals and agrochemicals, contributing to the development of diverse organic molecules for therapeutic and industrial purposes.
CAS Number | 1864059-03-9 |
Molecular Formula | C11H18ClN |
Purity | ≥95% |
IUPAC Name | 2-methyl-1-(4-methylphenyl)propan-1-amine;hydrochloride |
InChI | InChI=1S/C11H17N.ClH/c1-8(2)11(12)10-6-4-9(3)5-7-10;/h4-8,11H,12H2,1-3H3;1H |
InChIKey | QQAYCEWJQMBYRH-UHFFFAOYSA-N |
SMILES | CC1=CC=C(C=C1)C(C(C)C)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |