For research use only. Not for therapeutic Use.
2-(Methoxymethyl)phenol(Cat No.:L030713)is a high-purity compound commonly used in pharmaceutical research and organic synthesis. This methoxymethylated phenol is a valuable intermediate for developing bioactive molecules and complex aromatic compounds. Its structure allows for versatile applications, particularly in the synthesis of medicinal agents and fine chemicals. 2-(Methoxymethyl)phenol is essential for research focused on exploring new therapeutic candidates and optimizing synthetic pathways, providing reliable performance in advanced chemical synthesis and facilitating the development of novel pharmaceutical compounds.
| CAS Number | 5635-98-3 |
| Molecular Formula | C8H10O2 |
| Purity | ≥95% |
| IUPAC Name | 2-(methoxymethyl)phenol |
| InChI | InChI=1S/C8H10O2/c1-10-6-7-4-2-3-5-8(7)9/h2-5,9H,6H2,1H3 |
| InChIKey | SSICPQZWCDZSQA-UHFFFAOYSA-N |
| SMILES | COCC1=CC=CC=C1O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |