For research use only. Not for therapeutic Use.
2-Methoxy-4-(methylsulfanyl)aniline(Cat No.:L007282), is a chemical compound with significant importance in organic synthesis and pharmaceutical research. It belongs to the class of anilines, aromatic compounds containing an amino group attached to an aromatic ring. This compound finds applications in various chemical reactions, serving as a building block in the synthesis of complex molecules. Anilines, in general, are used in the production of dyes, agrochemicals, and pharmaceuticals. The presence of a methoxy group (-OCH3) and a methylsulfanyl group (-SCH3) in this compound enhances its reactivity and widens its utility in organic chemistry.
| CAS Number | 1657-84-7 |
| Molecular Formula | C8H11NOS |
| Purity | ≥95% |
| IUPAC Name | 2-methoxy-4-methylsulfanylaniline |
| InChI | InChI=1S/C8H11NOS/c1-10-8-5-6(11-2)3-4-7(8)9/h3-5H,9H2,1-2H3 |
| InChIKey | WPSKJCXEBQDCHJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)SC)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |