Home
>
Reference Standards>Organic Building Blocks>Buliding Block Chemicals> 2-Methoxy-4-amino-5-ethylsulfonylbenzoic Acid
For research use only. Not for therapeutic Use.
2-Methoxy-4-amino-5-ethylsulfonylbenzoic acid(CAT: R003067) is an aromatic benzoic acid derivative featuring a methoxy group at the 2-position, an amino group at the 4-position, and an ethylsulfonyl substituent at the 5-position. This multifunctional substitution pattern imparts both hydrophilic and electron-donating properties, making it a useful intermediate in pharmaceutical and agrochemical synthesis. Its structure allows for versatile chemical modifications, enabling the development of bioactive molecules such as enzyme inhibitors, antimicrobial agents, or herbicidal compounds. In research, it is valued for structure–activity relationship studies, offering potential in the design of compounds with targeted biological activity and improved physicochemical profiles.
| CAS Number | 71675-87-1 |
| Synonyms | 4-Amino-5-(ethylsulfonyl)-2-methoxybenzoic Acid; |
| Molecular Formula | C10H13NO5S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-amino-5-ethylsulfonyl-2-methoxybenzoic acid |
| InChI | InChI=1S/C10H13NO5S/c1-3-17(14,15)9-4-6(10(12)13)8(16-2)5-7(9)11/h4-5H,3,11H2,1-2H3,(H,12,13) |
| InChIKey | OJVNCXHGGYYOPH-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=C(C=C(C(=C1)C(=O)O)OC)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |