For research use only. Not for therapeutic Use.
2-Methoxy-3(or 5)-methylpyrazine (Cat.No:L003641) is a significant aromatic compound with a distinctive pyrazine ring structure. It is widely employed in the flavor and fragrance industry, imparting a unique, earthy, and nutty aroma. This compound is a key component in various food products, contributing to their overall sensory profile. Its versatility and importance in enhancing the sensory experience in food products highlight its crucial role in the flavor industry.
CAS Number | 68378-13-2 |
Molecular Formula | C12H16N4O2 |
Purity | ≥95% |
IUPAC Name | 2-methoxy-3-methylpyrazine;2-methoxy-5-methylpyrazine |
InChI | InChI=1S/2C6H8N2O/c1-5-3-8-6(9-2)4-7-5;1-5-6(9-2)8-4-3-7-5/h2*3-4H,1-2H3 |
InChIKey | OHEKWGBOPHATMI-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |