For research use only. Not for therapeutic Use.
2-Methoxy-3-methylphenol(CAT: I020835) is a naturally occurring phenolic compound commonly found in wood creosote and essential oils. It exhibits antioxidant, antimicrobial, and anti-inflammatory properties, making it a valuable compound in pharmaceutical and cosmetic research. Its chemical structure, featuring a methoxy group and a methyl group on the phenol ring, contributes to its reactivity and efficacy in free radical scavenging. 2-Methoxy-3-methylphenol is also used as a flavoring agent and preservative in various applications. In organic synthesis, it serves as an intermediate for creating more complex molecules, including pharmaceuticals and bioactive compounds.
| CAS Number | 18102-31-3 |
| Synonyms | 2-Methoxy-3-methylphenol |
| Molecular Formula | C8H10O2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 2-Methoxy-3-methylphenol |
| InChI | InChI=1S/C8H10O2/c1-6-4-3-5-7(9)8(6)10-2/h3-5,9H,1-2H3 |
| InChIKey | SHESIBIEPSTHMZ-UHFFFAOYSA-N |
| SMILES | OC1=CC=CC(C)=C1OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |