For research use only. Not for therapeutic Use.
2-Mercapto-4-methylpyrimidine hydrochloride（Cat No.:R070723）is a sulfur-containing heterocyclic compound with a pyrimidine core, featuring a thiol group at the 2-position and a methyl group at the 4-position. Presented as its hydrochloride salt, it offers improved solubility and stability for use in chemical synthesis. The thiol group provides a reactive site for forming thioethers, disulfides, or metal complexes, making the compound valuable in pharmaceutical research and coordination chemistry. Its pyrimidine ring is a common scaffold in bioactive molecules, enabling applications in the development of enzyme inhibitors, nucleoside analogs, and drug discovery programs.
| CAS Number | 6959-66-6 |
| Synonyms | 4-methyl-2-pyrimidinethiol |
| Molecular Formula | C5H7ClN2S |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 6-methyl-1H-pyrimidine-2-thione;hydrochloride |
| InChI | InChI=1S/C5H6N2S.ClH/c1-4-2-3-6-5(8)7-4;/h2-3H,1H3,(H,6,7,8);1H |
| InChIKey | UQJLPBLXSJWAKG-UHFFFAOYSA-N |
| SMILES | CC1=CC=NC(=S)N1.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
