Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2-Isonicotinoyl-N-(3-methoxyphenyl)hydrazine-1-carbothioamide
For research use only. Not for therapeutic Use.
2-Isonicotinoyl-N-(3-methoxyphenyl)hydrazine-1-carbothioamide(CAT: L000029) is a chemical compound of significance primarily in pharmaceutical and organic chemistry. In the pharmaceutical field, it serves as a crucial intermediate in the synthesis of various medications, impacting specific biological targets. Its action method involves its incorporation into drug molecules, contributing to the development of novel pharmaceutical agents. In organic chemistry, this compound is essential for designing and synthesizing a variety of organic molecules, playing a pivotal role in diversifying chemical synthesis.
CAS Number | 901286-50-8 |
Molecular Formula | C14H14N4O2S |
Purity | ≥95% |
IUPAC Name | 1-(3-methoxyphenyl)-3-(pyridine-4-carbonylamino)thiourea |
InChI | InChI=1S/C14H14N4O2S/c1-20-12-4-2-3-11(9-12)16-14(21)18-17-13(19)10-5-7-15-8-6-10/h2-9H,1H3,(H,17,19)(H2,16,18,21) |
InChIKey | CSNLUJBLISZGNT-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |