For research use only. Not for therapeutic Use.
(2-Iodophenyl)methanamine is a versatile chemical intermediate used in organic synthesis. Its structural moiety, the 2-iodophenyl group, is valuable in pharmaceutical and agrochemical industries for building more complex molecules. This compound serves as a precursor for various biologically active compounds and plays a significant role in the development of drugs and agrochemicals with targeted properties.
| CAS Number | 39959-51-8 |
| Molecular Formula | C7H8IN |
| Purity | ≥95% |
| IUPAC Name | (2-iodophenyl)methanamine |
| InChI | InChI=1S/C7H8IN/c8-7-4-2-1-3-6(7)5-9/h1-4H,5,9H2 |
| InChIKey | RHQNNLRITZIWGM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN)I |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
