For research use only. Not for therapeutic Use.
2-Iodobenzoic acid (Cat No.: R011392) is an aromatic carboxylic acid featuring an iodine atom at the ortho (2) position relative to the carboxyl group on a benzene ring. It serves as a versatile intermediate in organic synthesis, particularly in halogen exchange, metal-catalyzed coupling reactions (e.g., Suzuki or Sonogashira), and the preparation of hypervalent iodine reagents like IBX (o-iodoxybenzoic acid). Its iodine atom provides a reactive site for electrophilic substitution, making it valuable in the development of pharmaceuticals, agrochemicals, and advanced functional materials.
CAS Number | 88-67-5 |
Synonyms | o-Iodobenzoic Acid; 2-Carboxyphenyl Iodide; NSC 3772; |
Molecular Formula | C7H5IO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-iodobenzoic acid |
InChI | InChI=1S/C7H5IO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H,9,10) |
InChIKey | CJNZAXGUTKBIHP-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C(=O)O)I |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |