For research use only. Not for therapeutic Use.
2′-Iodoacetanilide (Cat No.: M012824) is an aromatic organic compound consisting of an acetanilide core with an iodine atom substituted at the ortho (2′) position of the phenyl ring. This halogenated derivative is used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and dye compounds. The presence of the iodine atom facilitates further functionalization through cross-coupling reactions, such as Suzuki or Sonogashira couplings. Its reactivity and structural features make it valuable in medicinal chemistry and organic synthesis for building complex molecular architectures.
CAS Number | 19591-17-4 |
Synonyms | 2′-IODOACETANILIDE |
Molecular Formula | C8H8INO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-(2-iodophenyl)acetamide |
InChI | InChI=1S/C8H8INO/c1-6(11)10-8-5-3-2-4-7(8)9/h2-5H,1H3,(H,10,11) |
InChIKey | BCJOKHQYEDXBSF-UHFFFAOYSA-N |
SMILES | CC(=O)NC1=CC=CC=C1I |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |