For research use only. Not for therapeutic Use.
2-Hydroxyterephthalaldehyde (Cat.No:L003903) is a pivotal compound in organic synthesis. Its unique structure, incorporating a hydroxyl group and terephthalaldehyde backbone, imparts distinctive reactivity. This compound is employed as a crucial intermediate in the preparation of specialized organic molecules with various industrial and pharmaceutical applications.
| CAS Number | 73289-90-4 |
| Molecular Formula | C8H6O3 |
| Purity | ≥95% |
| IUPAC Name | 2-hydroxyterephthalaldehyde |
| InChI | InChI=1S/C8H6O3/c9-4-6-1-2-7(5-10)8(11)3-6/h1-5,11H |
| InChIKey | DFIOBSJHIZBUCE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)O)C=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
