For research use only. Not for therapeutic Use.
2-(Hydroxymethyl)phenyl-β-D-glucopyranoside (Cat No.: M071307) is a glycosidic compound consisting of a β-D-glucose unit linked to a phenyl ring bearing a hydroxymethyl substituent at the ortho position. This molecule combines the hydrophilic properties of glucose with the aromatic functionality of the substituted phenol, making it useful in biochemical and pharmaceutical research. It may serve as a model compound for studying glycosidic bond stability, enzymatic hydrolysis, and carbohydrate–aromatic interactions. Its structural features also offer potential in designing prodrugs and targeted delivery systems.
| CAS Number | 138-52-3 |
| Synonyms | NSC 5751;D-(-)-Salicin |
| Molecular Formula | C13H18O7 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Storage | 3 years -20C powder |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[2-(hydroxymethyl)phenoxy]oxane-3,4,5-triol |
| InChI | InChI=1S/C13H18O7/c14-5-7-3-1-2-4-8(7)19-13-12(18)11(17)10(16)9(6-15)20-13/h1-4,9-18H,5-6H2/t9-,10-,11+,12-,13-/m1/s1 |
| InChIKey | NGFMICBWJRZIBI-UJPOAAIJSA-N |
| SMILES | InChI=1S/C13H18O7/c14-5-7-3-1-2-4-8(7)19-13-12(18)11(17)10(16)9(6-15)20-13/h1-4,9-18H,5-6H2/t9-,10-,11+,12-,13-/m1/s1 |
| Reference | Ehrlich, Steven D., NMD. /Willow Bark./ Rev. of <em>Herbal Drugs and Phytopharmaceuticals. Complementary Medicine</em> (2010): 1. Print</span></p> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
