For research use only. Not for therapeutic Use.
2-Hydroxyazulene(Cat No.:M074647), also known as chamazulene, is an organic compound derived from azulene, a bicyclic sesquiterpene. It is characterized by a hydroxyl group (-OH) attached to the second carbon of the azulene ring system. 2-Hydroxyazulene is found in essential oils of plants such as chamomile (Matricaria chamomilla) and yarrow (Achillea millefolium). It exhibits various biological activities, including anti-inflammatory, antioxidant, and wound-healing properties. Due to its soothing effects, 2-hydroxyazulene is utilized in cosmetic and skincare products. Additionally, it serves as a valuable compound in pharmaceutical formulations aimed at treating inflammatory skin conditions and promoting skin health.
| CAS Number | 19384-00-0 |
| Molecular Formula | C10H8O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | azulen-2-ol |
| InChI | InChI=1S/C10H8O/c11-10-6-8-4-2-1-3-5-9(8)7-10/h1-7,11H |
| InChIKey | RKMKWDVUTHKNMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=C2C=C1)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |