For research use only. Not for therapeutic Use.
2-Hydroxy-5-iodobenzyl alcohol is an aromatic compound commonly used in organic synthesis and pharmaceutical research. Its structure, featuring a hydroxyl group and an iodine atom on a benzyl alcohol framework, makes it a versatile intermediate for the synthesis of bioactive molecules, particularly in halogenation reactions. This compound is valuable for designing complex chemical entities, including drugs and agrochemicals. Its reactivity allows for further modifications, contributing to advancements in medicinal chemistry and material science applications.
CAS Number | 14056-07-6 |
Molecular Formula | C7H7IO2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 2-(hydroxymethyl)-4-iodophenol |
InChI | InChI=1S/C7H7IO2/c8-6-1-2-7(10)5(3-6)4-9/h1-3,9-10H,4H2 |
InChIKey | NXOVQYQJPVOXBC-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1I)CO)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |