For research use only. Not for therapeutic Use.
2-Hydroxy-4-methylbenzohydrazide(Cat No.:L007206), is a chemical compound. It features a benzene ring substituted with a hydroxy group at the 2nd position, a methyl group at the 4th position, and a hydrazide functional group at the 1st position. This compound is significant in organic synthesis and medicinal chemistry research. Its hydrazide motif is often employed as a versatile intermediate for the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and dyes. Researchers utilize 2-Hydroxy-4-methylbenzohydrazide in the development of specialized organic molecules, contributing to advancements in chemical research and applications.
| CAS Number | 69443-64-7 |
| Molecular Formula | C8H10N2O2 |
| Purity | ≥95% |
| IUPAC Name | 2-hydroxy-4-methylbenzohydrazide |
| InChI | InChI=1S/C8H10N2O2/c1-5-2-3-6(7(11)4-5)8(12)10-9/h2-4,11H,9H2,1H3,(H,10,12) |
| InChIKey | CIPACNIYKFAUQO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)NN)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |