For research use only. Not for therapeutic Use.
2-Heptadecanone is a long-chain ketone with a 17-carbon aliphatic chain and a ketone functional group at the second carbon position. This compound is found in various natural sources, including plants and insects, where it serves as a pheromone or chemical signal. 2-Heptadecanone has applications in fragrance and flavor industries due to its characteristic odor profile. It is also used in chemical synthesis as a building block for creating complex organic molecules with specific properties.
| CAS Number | 2922-51-2 |
| Synonyms | Methyl Pentadecyl Ketone; Pentadecyl Methyl Ketone; |
| Molecular Formula | C17H34O |
| Purity | ≥95% |
| Storage | Store at 4°C |
| IUPAC Name | heptadecan-2-one |
| InChI | InChI=1S/C17H34O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)18/h3-16H2,1-2H3 |
| InChIKey | TVTCXPXLRKTHAU-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCCCCCC(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |