For research use only. Not for therapeutic Use.
2-Fluoropropionic Acid is a fluorinated carboxylic acid with a fluorine atom positioned at the second carbon of the propionic acid chain. This compound is significant in organic synthesis and pharmaceutical research due to its ability to act as a versatile building block for the preparation of fluorinated organic molecules. Its unique properties impart enhanced reactivity and potential biological activity, making it valuable in the development of agrochemicals and therapeutic agents. Additionally, it is studied for its effects in biochemical pathways.
CAS Number | 6087-13-4 |
Synonyms | 2-Fluoropropanoic Acid; (±)-2-Fluoropropionic Acid; NSC 84352; α-Fluoropropionic Acid |
Molecular Formula | C3H5FO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-fluoropropanoic acid |
InChI | InChI=1S/C3H5FO2/c1-2(4)3(5)6/h2H,1H3,(H,5,6) |
InChIKey | ZVZPFTCEXIGSHM-UHFFFAOYSA-N |
SMILES | CC(C(=O)O)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |