For research use only. Not for therapeutic Use.
2-Fluoroisonicotinic acid(CAT: L026161) is a high-purity heterocyclic compound widely utilized in pharmaceutical and chemical research. Featuring a pyridine core with a fluorine atom at the 2-position and a carboxylic acid group, this compound serves as a versatile intermediate in the synthesis of bioactive molecules and drug candidates. Its unique structure and reactivity make it particularly valuable for applications in medicinal chemistry, such as the development of enzyme inhibitors, receptor modulators, and therapeutic agents. 2-Fluoroisonicotinic acid ensures reliable performance, supporting innovation in drug discovery, fine chemical production, and advanced organic synthesis.
CAS Number | 402-65-3 |
Molecular Formula | C6H4FNO2 |
Purity | ≥95% |
IUPAC Name | 2-fluoropyridine-4-carboxylic acid |
InChI | InChI=1S/C6H4FNO2/c7-5-3-4(6(9)10)1-2-8-5/h1-3H,(H,9,10) |
InChIKey | JMPFWDWYGOWUFP-UHFFFAOYSA-N |
SMILES | C1=CN=C(C=C1C(=O)O)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |