For research use only. Not for therapeutic Use.
2-Fluorobenzoic Acid (Cat. No: R048897) is an aromatic carboxylic acid with the molecular formula C7H5FO2. It consists of a benzene ring substituted with a fluorine atom at the ortho (2-) position and a carboxylic acid group at position 1. This compound is used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. The presence of the fluorine atom influences the compound’s reactivity and acidity, making it valuable in organic transformations, particularly in designing fluorinated analogs for drug development and material science.
| CAS Number | 445-29-4 |
| Synonyms | o-Fluorobenzoic Acid; NSC 10319; |
| Molecular Formula | C7H5FO2 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 2-fluorobenzoic acid |
| InChI | InChI=1S/C7H5FO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H,9,10) |
| InChIKey | NSTREUWFTAOOKS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |