For research use only. Not for therapeutic Use.
2-Fluoroanisole（Cat No.:R045230）is an aromatic organic compound featuring a methoxy group (-OCH₃) and a fluorine atom attached to a benzene ring in the ortho (2-) position. Its molecular formula is C₇H₇FO, and it exists as a colorless liquid with a pleasant, ether-like odor. 2-Fluoroanisole is used as an intermediate in pharmaceutical and agrochemical synthesis, as well as in materials science. The presence of both electron-donating (methoxy) and electron-withdrawing (fluoro) groups imparts unique electronic properties, making it valuable for electrophilic aromatic substitution reactions and the development of fluorinated aromatic compounds.
| CAS Number | 321-28-8 |
| Synonyms | 1-Fluoro-2-methoxy-benzene; o-Fluoro-anisole; 1-Fluoro-2-methoxybenzene; 2-Fluoro-1-methoxybenzene; 2-Fluoromethoxybenzene; 2-Methoxyfluorobenzene; NSC 10339; o-Fluoroanisole |
| Molecular Formula | C7H7FO |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | 1-fluoro-2-methoxybenzene |
| InChI | InChI=1S/C7H7FO/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3 |
| InChIKey | JIXDOBAQOWOUPA-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
