For research use only. Not for therapeutic Use.
2-Fluoro-6-isopropoxyphenylboronic acid(CAT: L039403) is a high-purity organoboron compound featuring a fluorinated phenyl ring with an isopropoxy group and a boronic acid functionality. This unique structure makes it a valuable intermediate in pharmaceutical research and organic synthesis, particularly for cross-coupling reactions such as Suzuki-Miyaura coupling. The fluorine and isopropoxy substitutions enhance its reactivity and facilitate the development of bioactive molecules, small-molecule inhibitors, and functionalized materials. 2-Fluoro-6-isopropoxyphenylboronic acid is ideal for precision synthesis in medicinal chemistry, agrochemical development, and material science, offering reliability and efficiency in both academic and industrial research settings.
| CAS Number | 870777-17-6 |
| Molecular Formula | C9H12BFO3 |
| Purity | ≥95% |
| IUPAC Name | (2-fluoro-6-propan-2-yloxyphenyl)boronic acid |
| InChI | InChI=1S/C9H12BFO3/c1-6(2)14-8-5-3-4-7(11)9(8)10(12)13/h3-6,12-13H,1-2H3 |
| InChIKey | WVAMTUDWTJMGSG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1F)OC(C)C)(O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |