For research use only. Not for therapeutic Use.
2-Fluoro-5-nitrobenzoyl chloride(CAT: L026445) is a high-purity aromatic compound widely utilized in pharmaceutical, chemical, and material science research. Featuring a benzoyl chloride core with a fluorine atom at the 2-position and a nitro group at the 5-position, this compound serves as a valuable intermediate for synthesizing bioactive molecules, including drug candidates and agrochemicals. Its reactive acyl chloride group makes it ideal for applications in acylation reactions, such as forming amides, esters, or other derivatives. 2-Fluoro-5-nitrobenzoyl chloride ensures consistent quality and performance, supporting innovative research in medicinal chemistry and advanced material development.
CAS Number | 709-46-6 |
Molecular Formula | C7H3ClFNO3 |
Purity | ≥95% |
IUPAC Name | 2-fluoro-5-nitrobenzoyl chloride |
InChI | InChI=1S/C7H3ClFNO3/c8-7(11)5-3-4(10(12)13)1-2-6(5)9/h1-3H |
InChIKey | SXJNRYPVXFTJOU-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(=O)Cl)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |