For research use only. Not for therapeutic Use.
2-Fluoro-5-(fluorosulfonyl)benzoic acid(Cat No.:L007789), is a chemical compound with the molecular formula C7H4F2O4S. This compound belongs to the benzoic acid class and contains both fluoro (F) and fluorosulfonyl (FSO₂) functional groups. Compounds featuring fluorosulfonyl moieties are of interest in various chemical applications due to their unique reactivity patterns. This specific compound could find applications in organic synthesis, especially in the creation of complex organic molecules. Its distinctive chemical structure makes it valuable for research in fields such as medicinal chemistry, where precise chemical manipulation is crucial for drug development efforts.
CAS Number | 1373233-37-4 |
Molecular Formula | C7H4F2O4S |
Purity | ≥95% |
IUPAC Name | 2-fluoro-5-fluorosulfonylbenzoic acid |
InChI | InChI=1S/C7H4F2O4S/c8-6-2-1-4(14(9,12)13)3-5(6)7(10)11/h1-3H,(H,10,11) |
InChIKey | QZUODPSUJVCAQE-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1S(=O)(=O)F)C(=O)O)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |