For research use only. Not for therapeutic Use.
2-Fluoro-4-methylaniline(Cat No.:L013641)is an aromatic amine featuring a fluorine atom at the ortho position and a methyl group at the para position relative to the amino group on a benzene ring. This compound serves as a versatile intermediate in pharmaceutical, agrochemical, and dye synthesis. Its electron-donating amine group and electron-withdrawing fluoro substituent create unique electronic properties, making it valuable for designing bioactive molecules. The compound is often utilized in the preparation of heterocycles, active pharmaceutical ingredients, and functional materials requiring fluorinated aromatic building blocks with defined substitution patterns.
| CAS Number | 452-80-2 |
| Molecular Formula | C7H8FN |
| Purity | ≥95% |
| IUPAC Name | 2-fluoro-4-methylaniline |
| InChI | InChI=1S/C7H8FN/c1-5-2-3-7(9)6(8)4-5/h2-4H,9H2,1H3 |
| InChIKey | ZQEXBVHABAJPHJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |