For research use only. Not for therapeutic Use.
2-Ethyl-4-fluoro-1-nitrobenzene(CAT: L024337) is a high-purity aromatic compound widely utilized in pharmaceutical, chemical, and material science research. Featuring an ethyl group, a fluorine atom, and a nitro group attached to a benzene ring, this compound serves as a versatile intermediate in the synthesis of bioactive molecules, advanced materials, and specialty chemicals. Its unique structure makes it particularly valuable in medicinal chemistry for the development of therapeutic agents, as well as in the study of structure-activity relationships. With excellent stability and reactivity, 2-Ethyl-4-fluoro-1-nitrobenzene ensures precision and reliability, making it an essential tool for innovative research and synthetic applications.
CAS Number | 1089279-29-7 |
Molecular Formula | C8H8FNO2 |
Purity | ≥95% |
IUPAC Name | 2-ethyl-4-fluoro-1-nitrobenzene |
InChI | InChI=1S/C8H8FNO2/c1-2-6-5-7(9)3-4-8(6)10(11)12/h3-5H,2H2,1H3 |
InChIKey | MQNMCCCUGXMTSZ-UHFFFAOYSA-N |
SMILES | CCC1=C(C=CC(=C1)F)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |