For research use only. Not for therapeutic Use.
2-Ethyl-2-propen-1-ol（Cat No.:C000983）, is a synthetic organic compound. It is a clear, colorless liquid with a characteristic odor. The compound contains a propenyl and an ethyl group. 2-Ethyl-2-propen-1-ol serves as a valuable intermediate in chemical synthesis and research, particularly in the production of specialty chemicals and pharmaceuticals. Its unique reactivity and functional groups make it valuable in various organic transformations.
| CAS Number | 4435-54-5 |
| Synonyms | 2-Methylene-1-butanol; 2-Ethyl-1-propen-3-ol; 2-Ethylallyl Alcohol |
| Molecular Formula | C₅H₁₀O |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Appearance | Colourless Oil |
| Storage | 4°C, Inert atmosphere, Light sensitive |
| IUPAC Name | 2-methylidenebutan-1-ol |
| InChI | InChI=1S/C5H10O/c1-3-5(2)4-6/h6H,2-4H2,1H3 |
| InChIKey | JKLUVCHKXQJGIG-UHFFFAOYSA-N |
| SMILES | CCC(=C)CO |
| Reference | Du, W., etal.:В J. Am. Chem. Soc.В 137, 1130 (2015); Zhao, Y., et al.: J. Org. Chem 74, 3211 (2009) |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
