2-Ethyl-1-hexanol is a high-purity branched alcohol essential for advanced pharmaceutical and chemical research. This compound is crucial for studies involving organic synthesis, plasticizer production, and solvent applications. Known for its stability and versatility, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in diverse scientific applications.
| Catalog Number | R018701 |
| CAS Number | 104-76-7 |
| Synonyms | (±)-2-Ethyl-1-hexanol; 2-Ethyl-1-hexanol; 2-Ethyl-1-hexyl alcohol; 2-Ethylhexanol; 2-Ethylhexyl alcohol; Conol 10WS; Ethylhexanol; G 301; Guerbet C8; NSC 9300 |
| Molecular Formula | C8H18O |
| Purity | 95% |
| Storage | Store at +4°C |
| IUPAC Name | 2-ethylhexan-1-ol |
| InChI | InChI=1S/C8H18O/c1-3-5-6-8(4-2)7-9/h8-9H,3-7H2,1-2H3 |
| InChIKey | YIWUKEYIRIRTPP-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)CO |
