2-Ethenyl-5-methyl-furan(Cat No.:M061797) is an organic compound characterized by a furan ring—a five-membered aromatic ring containing an oxygen atom—with a vinyl (ethenyl) group attached at the second carbon and a methyl group at the fifth carbon. This structure makes it a substituted furan, which is important in organic chemistry due to its potential reactivity and utility as a building block in synthetic chemistry. The compound finds applications in the synthesis of various polymers, pharmaceuticals, and aromatic compounds, leveraging its vinyl group for polymerization and other chemical modifications.
Catalog Number | M061797 |
CAS Number | 10504-13-9 |
Molecular Formula | C7H8O |
Purity | 95% |
Storage | -20°C |
IUPAC Name | 2-ethenyl-5-methylfuran |
InChI | InChI=1S/C7H8O/c1-3-7-5-4-6(2)8-7/h3-5H,1H2,2H3 |
InChIKey | LTQOQNQWJBSGPF-UHFFFAOYSA-N |
SMILES | CC1=CC=C(O1)C=C |