For research use only. Not for therapeutic Use.
2-(Diphenylphosphino)phenol（Cat No.:L034812）is a bifunctional ligand featuring a phenol group and a diphenylphosphino moiety attached to adjacent positions on a benzene ring. This compound is widely used in coordination and organometallic chemistry, especially as a chelating ligand in homogeneous catalysis. The phenolic hydroxyl group can engage in hydrogen bonding or metal coordination, while the phosphine group serves as a strong σ-donor, stabilizing metal complexes. Its unique electronic and steric properties make it valuable in catalytic applications such as hydrogenation, cross-coupling, and C–H activation, offering tunable reactivity and selectivity in complex synthetic transformations.
| CAS Number | 60254-10-6 |
| Molecular Formula | C18H15OP |
| Purity | ≥95% |
| IUPAC Name | 2-diphenylphosphanylphenol |
| InChI | InChI=1S/C18H15OP/c19-17-13-7-8-14-18(17)20(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,19H |
| InChIKey | HGHOYIFINVBZKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
