2-(Dimethylamino)acetaldehyde（Cat No.:I017273） is a chemical compound used in the synthesis of muscarine analogs. Muscarine is a naturally occurring compound found in certain mushrooms and acts as a selective agonist of muscarinic acetylcholine receptors. By modifying the structure of muscarine through the introduction of the dimethylamino group, analogs with altered pharmacological properties can be created. These analogs may be employed in research and drug development to better understand muscarinic receptor function and explore potential therapeutic applications in various physiological and pathological processes related to cholinergic signaling.
| Catalog Number | I017273 |
| CAS Number | 52334-92-6 |
| Molecular Formula | C₄H₉NO |
| Purity | ≥95% |
| IUPAC Name | 2-(dimethylamino)acetaldehyde |
| InChI | InChI=1S/C4H9NO/c1-5(2)3-4-6/h4H,3H2,1-2H3 |
| InChIKey | GRWPTSXPZYCYOM-UHFFFAOYSA-N |
| SMILES | CN(C)CC=O |
| Reference | [1]. Kenneth Bowden, et al. The Synthesis of Some Compounds related to Muscarine. Royal Society of Chemistry. 1978. |
