2-Diisopropylaminoethyl methacrylate (Cat No.:M082265) is a functional methacrylate monomer characterized by the presence of a diisopropylamine group attached to an ethyl chain, which is linked to a methacrylate structure. This configuration imparts DPAEMA with unique properties such as increased hydrophilicity and reactivity, making it highly useful in polymer chemistry. It is commonly used to synthesize smart polymers and hydrogels that respond to changes in pH, temperature, or ionic strength, making them ideal for drug delivery systems, tissue engineering, and biosensors. DPAEMA’s ability to form polymers with tailored properties supports innovative applications in biotechnology and materials science.
| Catalog Number | M082265 |
| CAS Number | 16715-83-6 |
| Molecular Formula | C12H23NO2 |
| Purity | 95% |
| Storage | Store at -20°C |
| IUPAC Name | 2-[di(propan-2-yl)amino]ethyl 2-methylprop-2-enoate |
| InChI | InChI=1S/C12H23NO2/c1-9(2)12(14)15-8-7-13(10(3)4)11(5)6/h10-11H,1,7-8H2,2-6H3 |
| InChIKey | SVYHMICYJHWXIN-UHFFFAOYSA-N |
| SMILES | CC(C)N(CCOC(=O)C(=C)C)C(C)C |
