For research use only. Not for therapeutic Use.
2-(Dicyclohexylphosphino)-2’,6’-di-isopropoxy-1,1’-biphenyl (Cat No.: R045673) is a bulky, electron-rich biaryl phosphine ligand widely used in palladium-catalyzed cross-coupling reactions, including Suzuki–Miyaura and Buchwald–Hartwig aminations. Its dicyclohexylphosphino group offers strong σ-donating ability, while the di-isopropoxy substitution enhances steric hindrance and solubility, promoting high reactivity and selectivity. This ligand is particularly valuable in challenging C–C and C–N bond formations under mild conditions. It plays a crucial role in pharmaceutical synthesis, fine chemical production, and advanced materials development, supporting efficient catalytic processes with broad substrate scope.
CAS Number | 787618-22-8 |
Synonyms | [2’,6’-bis(1-Methylethoxy)[1,1’-biphenyl]-2-yl]dicyclohexyl-phosphine; 2-(Dicyclohexylphosphino)-2’,6’-isopropoxybiphenyl; RuPhos |
Molecular Formula | C30H43O2P |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | dicyclohexyl-[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane |
InChI | InChI=1S/C30H43O2P/c1-22(2)31-27-19-13-20-28(32-23(3)4)30(27)26-18-11-12-21-29(26)33(24-14-7-5-8-15-24)25-16-9-6-10-17-25/h11-13,18-25H,5-10,14-17H2,1-4H3 |
InChIKey | MXFYYFVVIIWKFE-UHFFFAOYSA-N |
SMILES | CC(C)OC1=C(C(=CC=C1)OC(C)C)C2=CC=CC=C2P(C3CCCCC3)C4CCCCC4 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |