For research use only. Not for therapeutic Use.
2′-Deoxy-5-formylcytidine（Cat No.:I044112）is a modified nucleoside derived from cytidine, featuring a formyl group at the 5-position of the cytosine ring and a deoxyribose sugar. It is a key intermediate in active DNA demethylation pathways, arising from the oxidation of 5-methylcytosine by TET (Ten-Eleven Translocation) enzymes. This epigenetic mark plays a crucial role in gene expression regulation, development, and cellular reprogramming. 2′-Deoxy-5-formylcytidine is widely used in studies of DNA methylation dynamics, epigenetic editing, and chromatin remodeling, offering insights into cancer biology, stem cell function, and developmental processes.
| CAS Number | 137017-45-9 |
| Synonyms | 4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidine-5-carbaldehyde |
| Molecular Formula | C10H13N3O5 |
| Purity | ≥95% |
| IUPAC Name | 4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidine-5-carbaldehyde |
| InChI | InChI=1S/C10H13N3O5/c11-9-5(3-14)2-13(10(17)12-9)8-1-6(16)7(4-15)18-8/h2-3,6-8,15-16H,1,4H2,(H2,11,12,17)/t6-,7+,8+/m0/s1 |
| InChIKey | QBADNGFALQJSIH-XLPZGREQSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=C(C(=NC2=O)N)C=O)CO)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
