For research use only. Not for therapeutic Use.
2-Deoxy-2,2-difluoro-D-erythro-pentofuranos-1-ulose-3,5-dibenzoate (Cat No.: R003629) is a fluorinated sugar derivative used as a key intermediate in the synthesis of antiviral nucleoside analogs, including gemcitabine. Its structure includes a difluorinated sugar ring with ketone functionality at the 1-position and benzoate protecting groups at the 3 and 5 positions, enhancing stability and handling during synthesis. The difluoro modification contributes to metabolic stability and bioactivity. This compound plays a critical role in medicinal chemistry, especially in the development of anticancer and antiviral therapeutics.
| CAS Number | 122111-01-7 |
| Synonyms | 2-Deoxy-2,2-difluoro-D-erythro-pentonic Acid γ-Lactone 3,5-Dibenzoate; |
| Molecular Formula | C19H14F2O6 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | [(2R,3R)-3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl]methyl benzoate |
| InChI | InChI=1S/C19H14F2O6/c20-19(21)15(27-17(23)13-9-5-2-6-10-13)14(26-18(19)24)11-25-16(22)12-7-3-1-4-8-12/h1-10,14-15H,11H2/t14-,15-/m1/s1 |
| InChIKey | SHHNEUNVMZNOID-HUUCEWRRSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(=O)O2)(F)F)OC(=O)C3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
