For research use only. Not for therapeutic Use.
2-Cyclopropyl-6-methylphenol(Cat No.:L043323)is an aromatic compound used in pharmaceutical and chemical research, particularly as an intermediate in organic synthesis. This molecule features a cyclopropyl group and a methyl group attached to a phenol ring, making it a valuable building block for creating complex molecules. It is often employed in the development of bioactive compounds, including potential drug candidates. The combination of cyclopropyl and methyl substituents provides unique chemical properties, allowing for diverse reactivity and functionality in medicinal chemistry and materials science.
| CAS Number | 499236-68-9 |
| Molecular Formula | C10H12O |
| Purity | ≥95% |
| IUPAC Name | 2-cyclopropyl-6-methylphenol |
| InChI | InChI=1S/C10H12O/c1-7-3-2-4-9(10(7)11)8-5-6-8/h2-4,8,11H,5-6H2,1H3 |
| InChIKey | PRQKVXNVZPBESR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C2CC2)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |