2-(Cyclooct-2-yn-1-yloxy)acetic acid - CAS 917756-42-4

2-(Cyclooct-2-yn-1-yloxy)acetic acid (Cat.No:L005328) is a significant chemical compound with diverse applications. Its unique structure incorporates a cyclooctyne moiety linked to an acetic acid group, offering versatile reactivity. This compound serves as a valuable building block in organic synthesis, particularly in the preparation of specialized molecules for pharmaceutical and materials science research.

Catalog Number: L005328

CAS Number: 917756-42-4

Molecular Formula: C10H14O3

Molecular Weight:182.22

Purity: ≥95%

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C10H14O3
Molecular Weight182.22
Purity≥95%

Computed Descriptor

IUPAC Name2-cyclooct-2-yn-1-yloxyacetic acid
InChIInChI=1S/C10H14O3/c11-10(12)8-13-9-6-4-2-1-3-5-7-9/h9H,1-4,6,8H2,(H,11,12)
InChIKeyQUIAKSQMOGTDQJ-UHFFFAOYSA-N
SMILESC1CCC#CC(CC1)OCC(=O)O