Home
>
Chemical Reagents>Organometallic Reagents> 2-(Cyclohexylidenemethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
For research use only. Not for therapeutic Use.
2-(Cyclohexylidenemethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane(Cat No.:L007307), is a chemical compound widely used in organic synthesis and medicinal chemistry. This compound belongs to the class of organic compounds known as boronic acids, which are versatile building blocks in the synthesis of complex organic molecules. Its unique boron-containing structure allows it to participate in various reactions, including Suzuki-Miyaura cross-coupling reactions, enabling the creation of diverse compounds for drug discovery, materials science, and other scientific applications. Researchers utilize this compound to develop novel pharmaceuticals, agrochemicals, and functional materials due to its ability to form crucial bonds in organic synthesis.
| CAS Number | 74213-49-3 |
| Molecular Formula | C13H23BO2 |
| Purity | ≥95% |
| IUPAC Name | 2-(cyclohexylidenemethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChI | InChI=1S/C13H23BO2/c1-12(2)13(3,4)16-14(15-12)10-11-8-6-5-7-9-11/h10H,5-9H2,1-4H3 |
| InChIKey | RNSMPCBEIXODBX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C=C2CCCCC2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |