For research use only. Not for therapeutic Use.
(2-Chloroquinolin-7-yl)methanol(CAT: L048928) is a high-purity quinoline derivative featuring a chlorinated aromatic structure and a hydroxymethyl functional group. This versatile compound is widely utilized in pharmaceutical and chemical research, particularly as a building block for synthesizing complex organic molecules and bioactive compounds. Its unique structure makes it a valuable tool in medicinal chemistry for exploring novel therapeutic agents. With reliable quality and consistent performance, (2-Chloroquinolin-7-yl)methanol supports cutting-edge research in drug discovery, organic synthesis, and material science, enabling innovative advancements in various scientific fields.
CAS Number | 1823116-42-2 |
Molecular Formula | C10H8ClNO |
Purity | ≥95% |
IUPAC Name | (2-chloroquinolin-7-yl)methanol |
InChI | InChI=1S/C10H8ClNO/c11-10-4-3-8-2-1-7(6-13)5-9(8)12-10/h1-5,13H,6H2 |
InChIKey | FGTCZEJPOPGONN-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |