For research use only. Not for therapeutic Use.
2-Chlorophenol (CAT: R069057) is a chlorinated aromatic compound with a phenolic structure. It is widely used in various applications, including as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and dyes. 2-Chlorophenol can also be used as a chemical reagent in various organic transformations. Additionally, it has been employed as a precursor for the production of pesticides and fungicides.
| CAS Number | 95-57-8 |
| Synonyms | o-Chlorophenol |
| Molecular Formula | C6H5ClO |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 2-chlorophenol |
| InChI | InChI=1S/C6H5ClO/c7-5-3-1-2-4-6(5)8/h1-4,8H |
| InChIKey | ISPYQTSUDJAMAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)O)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |