For research use only. Not for therapeutic Use.
2-(Chloromethyl)-5-methylpyrazine hydrochloride is a chlorinated pyrazine derivative featuring a chloromethyl group at the 2-position and a methyl group at the 5-position. This compound is significant in organic synthesis and medicinal chemistry, where it may serve as an intermediate for the development of various pharmaceuticals. Its unique structure allows for potential biological activities, including antimicrobial and anti-inflammatory properties. The presence of the chloromethyl group enhances its reactivity, making it valuable for further chemical transformations and compound optimization.
CAS Number | 128229-06-1 |
Molecular Formula | C6H8Cl2N2 |
Purity | ≥95% |
IUPAC Name | 2-(chloromethyl)-5-methylpyrazine;hydrochloride |
InChI | InChI=1S/C6H7ClN2.ClH/c1-5-3-9-6(2-7)4-8-5;/h3-4H,2H2,1H3;1H |
InChIKey | XCGNTLZPQQWVOK-UHFFFAOYSA-N |
SMILES | CC1=CN=C(C=N1)CCl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |