For research use only. Not for therapeutic Use.
p-Benzoquinone（Cat No.:R020908）, also known as para-benzoquinone or simply quinone, is a yellow, crystalline organic compound with a highly conjugated diketone structure. It serves as a key oxidizing agent in organic synthesis, particularly in dehydrogenation reactions, oxidative coupling, and redox cycling. p-Benzoquinone is also used in the manufacture of dyes, fungicides, and photographic chemicals. In biochemical research, it plays a role in studying electron transport and enzyme inhibition. Its reactive carbonyl groups and aromatic ring make it a valuable intermediate in both industrial and laboratory-scale applications.
| CAS Number | 106-51-4 |
| Synonyms | 1,4-Benzoquinone; 1,4-Cyclohexadienedione; 1,4-Dione-2,5-cyclohexadiene; Chinone; NSC 36324; PBQ 2; Quinone; Stearer PBQ; p-Quinone |
| Molecular Formula | C6H4O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione |
| InChI | InChI=1S/C6H4O2/c7-5-1-2-6(8)4-3-5/h1-4H |
| InChIKey | AZQWKYJCGOJGHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)C=CC1=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
