Home
>
Chemical Reagents>Organic Building Blocks> 2-chloro-N-[1-(2-methoxyphenyl)ethyl]-N-methylacetamide
For research use only. Not for therapeutic Use.
2-chloro-N-[1-(2-methoxyphenyl)ethyl]-N-methylacetamide(Cat No.:L007576), is a chemical compound characterized by a chloro group attached to an acetamide moiety, along with a methyl group and an ethyl group substituted at the nitrogen atom. This specific molecular arrangement makes it valuable in medicinal chemistry and drug discovery. Researchers study its interactions with biological targets, exploring its potential applications as a pharmaceutical agent. Its versatile structure allows for various chemical modifications, enabling the design and synthesis of diverse derivatives.
CAS Number | 1179271-04-5 |
Molecular Formula | C12H16ClNO2 |
Purity | ≥95% |
IUPAC Name | 2-chloro-N-[1-(2-methoxyphenyl)ethyl]-N-methylacetamide |
InChI | InChI=1S/C12H16ClNO2/c1-9(14(2)12(15)8-13)10-6-4-5-7-11(10)16-3/h4-7,9H,8H2,1-3H3 |
InChIKey | FNPUQTZECOTDQY-UHFFFAOYSA-N |
SMILES | CC(C1=CC=CC=C1OC)N(C)C(=O)CCl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |