For research use only. Not for therapeutic Use.
2-Chloro-6-(methylamino)purine(Cat No.:L002469)is a purine derivative widely used in pharmaceutical and biochemical research. Featuring a purine ring with a chlorine atom at the 2-position and a methylamino group at the 6-position, this compound is valuable in the synthesis of nucleoside analogs and other bioactive molecules. Its structure allows for selective modifications, making it essential in the development of antiviral and anticancer agents. Additionally, 2-Chloro-6-(methylamino)purine is used in studying enzyme interactions and nucleic acid chemistry, contributing to advancements in drug discovery and molecular biology.
| CAS Number | 82499-02-3 |
| Molecular Formula | C6H6ClN5 |
| Purity | ≥95% |
| IUPAC Name | 2-chloro-N-methyl-7H-purin-6-amine |
| InChI | InChI=1S/C6H6ClN5/c1-8-4-3-5(10-2-9-3)12-6(7)11-4/h2H,1H3,(H2,8,9,10,11,12) |
| InChIKey | RIAVUEFUPHOGJY-UHFFFAOYSA-N |
| SMILES | CNC1=NC(=NC2=C1NC=N2)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |