For research use only. Not for therapeutic Use.
2-Chloro-6-(trifluoromethyl)phenylboronic acid(Cat No.:L015436)is a boronic acid derivative featuring a chlorinated and trifluoromethyl-substituted phenyl ring. This compound is commonly used in pharmaceutical research and organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions, to form carbon-carbon bonds. Its trifluoromethyl and chlorine groups enhance its reactivity and make it valuable for creating complex fluorinated and aromatic compounds. Researchers utilize this compound to develop novel drug candidates, agrochemicals, and materials, making it an essential tool in medicinal chemistry and advanced synthetic chemistry applications.
CAS Number | 851756-52-0 |
Molecular Formula | C7H5BClF3O2 |
Purity | ≥95% |
IUPAC Name | [2-chloro-6-(trifluoromethyl)phenyl]boronic acid |
InChI | InChI=1S/C7H5BClF3O2/c9-5-3-1-2-4(7(10,11)12)6(5)8(13)14/h1-3,13-14H |
InChIKey | ARGDVPMTQZNUBG-UHFFFAOYSA-N |
SMILES | B(C1=C(C=CC=C1Cl)C(F)(F)F)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |