For research use only. Not for therapeutic Use.
2-Chloro-6-hydroxypyridine-4-carbonitrile(Cat No.:L007389), is a key compound in the field of medicinal chemistry. This chemical structure, featuring a chloro group, a hydroxy group, and a cyano group on a pyridine ring, holds significance in pharmaceutical research and drug development. Scientists utilize this compound as a building block in the synthesis of various biologically active molecules. Its specific reactivity and versatility make it valuable for creating potential drug candidates. Researchers explore its unique properties to design new therapeutic agents, contributing to advancements in the field of pharmaceutical science and healthcare.
CAS Number | 1556812-05-5 |
Molecular Formula | C6H3ClN2O |
Purity | ≥95% |
IUPAC Name | 2-chloro-6-oxo-1H-pyridine-4-carbonitrile |
InChI | InChI=1S/C6H3ClN2O/c7-5-1-4(3-8)2-6(10)9-5/h1-2H,(H,9,10) |
InChIKey | PZBFXMLZXFRMFH-UHFFFAOYSA-N |
SMILES | C1=C(C=C(NC1=O)Cl)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |