For research use only. Not for therapeutic Use.
(2-Chloro-6-fluorophenyl)boronic acid(Cat No.:R072993)is a halogenated arylboronic acid featuring chlorine and fluorine substituents at the 2- and 6-positions of a phenyl ring. It is widely used as a building block in Suzuki-Miyaura cross-coupling reactions for forming carbon–carbon bonds, especially in the synthesis of biaryl and heteroaryl compounds. The electron-withdrawing halogens influence the ring’s electronic properties, enhancing selectivity and reactivity in complex molecule construction. This compound is highly valuable in pharmaceutical and agrochemical research, aiding in the development of fluorinated scaffolds with improved metabolic stability, bioavailability, and structure–activity profile optimization.
| CAS Number | 313545-32-3 |
| Molecular Formula | C6H5BClFO2 |
| Purity | ≥95% |
| IUPAC Name | (2-chloro-6-fluorophenyl)boronic acid |
| InChI | InChI=1S/C6H5BClFO2/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3,10-11H |
| InChIKey | NXSZSZJWZVLHAY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1Cl)F)(O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |