For research use only. Not for therapeutic Use.
2-Chloro-5-nitrothiazole(CAT: L041592) is a high-purity heterocyclic compound featuring a chloro group at the 2-position and a nitro group at the 5-position of the thiazole ring. This molecule is widely used as a versatile intermediate in pharmaceutical research and agrochemical development, particularly for synthesizing bioactive compounds such as antibacterial, antifungal, or antiparasitic agents. The electron-withdrawing nitro group and the reactive chlorine atom make it suitable for nucleophilic substitution reactions and further functionalization, facilitating the construction of complex heterocyclic frameworks. 2-Chloro-5-nitrothiazole is highly valued for its stability, reactivity, and utility in precision-driven medicinal chemistry and advanced synthetic applications.
CAS Number | 3034-47-7 |
Molecular Formula | C3HClN2O2S |
Purity | ≥95% |
IUPAC Name | 2-chloro-5-nitro-1,3-thiazole |
InChI | InChI=1S/C3HClN2O2S/c4-3-5-1-2(9-3)6(7)8/h1H |
InChIKey | USOMXSLAPRWFCV-UHFFFAOYSA-N |
SMILES | C1=C(SC(=N1)Cl)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |